C34H48N8O7S — CID 90966783
methyl (2S)-2-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-2,6-dimethylphenyl]sulfonylamino]-3-[[1-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propyl]indazole-5-carbonyl]amino]propanoate (PubChem CID 90966783) has the molecular formula C34H48N8O7S and a molecular weight of 712.87 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-2,6-dimethylphenyl]sulfonylamino]-3-[[1-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propyl]indazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-2,6-dimethylphenyl]sulfonylamino]-3-[[1-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propyl]indazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 90966783 |
| Molecular Formula | C34H48N8O7S |
| Molecular Weight | 712.87 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | methyl (2S)-2-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-2,6-dimethylphenyl]sulfonylamino]-3-[[1-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propyl]indazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CNC(=O)c1ccc2c(cnn2CCCNC2=NCCCC2)c1)NS(=O)(=O)c1c(C)cc(OCCCC(=O)NCCN)cc1C |
| InChI | InChI=1S/C34H48N8O7S/c1-23-18-27(49-17-6-9-31(43)38-15-12-35)19-24(2)32(23)50(46,47)41-28(34(45)48-3)22-39-33(44)25-10-11-29-26(20-25)21-40-42(29)16-7-14-37-30-8-4-5-13-36-30/h10-11,18-21,28,41H,4-9,12-17,22,35H2,1-3H3,(H,36,37)(H,38,43)(H,39,44)/t28-/m0/s1 |
| InChIKey | PTVZLFKDYHIRLA-NDEPHWFRSA-N |
| XLogP | 1.70 |
| TPSA | 208.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|