C28H32N6O5S — CID 22006718
3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 22006718) has the molecular formula C28H32N6O5S and a molecular weight of 564.67 g/mol. Its IUPAC name is 3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 22006718 |
| Molecular Formula | C28H32N6O5S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(CNC(=O)c2ccc3c(cnn3CCCNc3ccccn3)c2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C28H32N6O5S/c1-18-13-19(2)26(20(3)14-18)40(38,39)33-23(28(36)37)17-31-27(35)21-8-9-24-22(15-21)16-32-34(24)12-6-11-30-25-7-4-5-10-29-25/h4-5,7-10,13-16,23,33H,6,11-12,17H2,1-3H3,(H,29,30)(H,31,35)(H,36,37) |
| InChIKey | BDSVWPXYUWYWIQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|