C44H41N7O5 — CID 20707264
2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoic acid (PubChem CID 20707264) has the molecular formula C44H41N7O5 and a molecular weight of 747.86 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20707264 |
| Molecular Formula | C44H41N7O5 |
| Molecular Weight | 747.86 g/mol |
| Exact Mass | 747.32 |
| IUPAC Name | 2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC(CNC(=O)c1ccc2c(cnn2CCCNc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C44H41N7O5/c52-40(47-30-38(41(53)54)49-43(55)56-31-32-14-5-1-6-15-32)33-22-23-39-34(28-33)29-48-51(39)26-13-24-45-42-46-25-27-50(42)44(35-16-7-2-8-17-35,36-18-9-3-10-19-36)37-20-11-4-12-21-37/h1-12,14-23,25,27-29,38H,13,24,26,30-31H2,(H,45,46)(H,47,52)(H,49,55)(H,53,54) |
| InChIKey | CPFMFCZKHIOLAU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 152.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.86 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|