C8H10O4 — CID 163746906
ethyl (2R)-2-formyl-2,3-dihydrofuran-5-carboxylate (PubChem CID 163746906) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is ethyl (2R)-2-formyl-2,3-dihydrofuran-5-carboxylate.
| Compound Name | ethyl (2R)-2-formyl-2,3-dihydrofuran-5-carboxylate |
|---|---|
| PubChem CID | 163746906 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | ethyl (2R)-2-formyl-2,3-dihydrofuran-5-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H](C=O)O1 |
| InChI | InChI=1S/C8H10O4/c1-2-11-8(10)7-4-3-6(5-9)12-7/h4-6H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | LMQPRPGLQKNXLZ-ZCFIWIBFSA-N |
| XLogP | 0.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|