C15H20O5 — CID 56851327
ethyl (2E)-4-cyclopropyl-2-(2-ethoxy-2-oxoethylidene)-3,4-dihydropyran-6-carboxylate (PubChem CID 56851327) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl (2E)-4-cyclopropyl-2-(2-ethoxy-2-oxoethylidene)-3,4-dihydropyran-6-carboxylate.
| Compound Name | ethyl (2E)-4-cyclopropyl-2-(2-ethoxy-2-oxoethylidene)-3,4-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 56851327 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | ethyl (2E)-4-cyclopropyl-2-(2-ethoxy-2-oxoethylidene)-3,4-dihydropyran-6-carboxylate |
| SMILES | CCOC(=O)/C=C1\CC(C2CC2)C=C(C(=O)OCC)O1 |
| InChI | InChI=1S/C15H20O5/c1-3-18-14(16)9-12-7-11(10-5-6-10)8-13(20-12)15(17)19-4-2/h8-11H,3-7H2,1-2H3/b12-9+ |
| InChIKey | UVQMPFXEQNYGFN-FMIVXFBMSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|