C21H29O6P — CID 56850844
ethyl (2E)-2-[6-di(propan-2-yloxy)phosphoryl-4-phenyl-3,4-dihydropyran-2-ylidene]acetate (PubChem CID 56850844) has the molecular formula C21H29O6P and a molecular weight of 408.43 g/mol. Its IUPAC name is ethyl (2E)-2-[6-di(propan-2-yloxy)phosphoryl-4-phenyl-3,4-dihydropyran-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[6-di(propan-2-yloxy)phosphoryl-4-phenyl-3,4-dihydropyran-2-ylidene]acetate |
|---|---|
| PubChem CID | 56850844 |
| Molecular Formula | C21H29O6P |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl (2E)-2-[6-di(propan-2-yloxy)phosphoryl-4-phenyl-3,4-dihydropyran-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC(c2ccccc2)C=C(P(=O)(OC(C)C)OC(C)C)O1 |
| InChI | InChI=1S/C21H29O6P/c1-6-24-20(22)14-19-12-18(17-10-8-7-9-11-17)13-21(25-19)28(23,26-15(2)3)27-16(4)5/h7-11,13-16,18H,6,12H2,1-5H3/b19-14+ |
| InChIKey | MBYULYIEOUILKM-XMHGGMMESA-N |
| XLogP | 5.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|