C19H19ClN2O2 — CID 135023119
ethyl (2Z)-2-(7-chloro-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate (PubChem CID 135023119) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is ethyl (2Z)-2-(7-chloro-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(7-chloro-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate |
|---|---|
| PubChem CID | 135023119 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl (2Z)-2-(7-chloro-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/CC(c2ccccc2)Nc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-2-24-19(23)12-15-11-17(13-6-4-3-5-7-13)22-16-9-8-14(20)10-18(16)21-15/h3-10,12,17,21-22H,2,11H2,1H3/b15-12- |
| InChIKey | NIRWDUYMWBYURZ-QINSGFPZSA-N |
| XLogP | 4.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|