C20H22N2O2 — CID 102227512
ethyl (2Z)-2-(7-methyl-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate (PubChem CID 102227512) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl (2Z)-2-(7-methyl-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(7-methyl-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate |
|---|---|
| PubChem CID | 102227512 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | ethyl (2Z)-2-(7-methyl-2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/CC(c2ccccc2)Nc2ccc(C)cc2N1 |
| InChI | InChI=1S/C20H22N2O2/c1-3-24-20(23)13-16-12-18(15-7-5-4-6-8-15)22-17-10-9-14(2)11-19(17)21-16/h4-11,13,18,21-22H,3,12H2,1-2H3/b16-13- |
| InChIKey | UVXREDJEMDYYFX-SSZFMOIBSA-N |
| XLogP | 4.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|