C20H17NO3 — CID 70373641
ethyl 4-oxo-2,6-diphenyl-3H-pyridine-3-carboxylate (PubChem CID 70373641) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 4-oxo-2,6-diphenyl-3H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-oxo-2,6-diphenyl-3H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 70373641 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl 4-oxo-2,6-diphenyl-3H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C20H17NO3/c1-2-24-20(23)18-17(22)13-16(14-9-5-3-6-10-14)21-19(18)15-11-7-4-8-12-15/h3-13,18H,2H2,1H3 |
| InChIKey | HINWDFRXSOVTRH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|