C19H18N2O5S — CID 15352379
diethyl 3-amino-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-2,5-dicarboxylate (PubChem CID 15352379) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is diethyl 3-amino-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-2,5-dicarboxylate.
| Compound Name | diethyl 3-amino-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 15352379 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | diethyl 3-amino-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc2c(c1N)=C(c1ccccc1)C(C(=O)OCC)C(=O)N=2 |
| InChI | InChI=1S/C19H18N2O5S/c1-3-25-18(23)13-11(10-8-6-5-7-9-10)12-14(20)15(19(24)26-4-2)27-17(12)21-16(13)22/h5-9,13H,3-4,20H2,1-2H3 |
| InChIKey | PWGWUVGXJAKDMB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|