C23H18N2O4S — CID 15352375
ethyl 3-amino-2-benzoyl-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-5-carboxylate (PubChem CID 15352375) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl 3-amino-2-benzoyl-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 3-amino-2-benzoyl-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 15352375 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | ethyl 3-amino-2-benzoyl-6-oxo-4-phenyl-5H-thieno[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N=c2sc(C(=O)c3ccccc3)c(N)c2=C1c1ccccc1 |
| InChI | InChI=1S/C23H18N2O4S/c1-2-29-23(28)17-15(13-9-5-3-6-10-13)16-18(24)20(30-22(16)25-21(17)27)19(26)14-11-7-4-8-12-14/h3-12,17H,2,24H2,1H3 |
| InChIKey | UADUFAFUXZWRLX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|