C19H18O3 — CID 124637729
ethyl (1R)-2-oxo-6-phenyl-3,4-dihydro-1H-naphthalene-1-carboxylate (PubChem CID 124637729) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl (1R)-2-oxo-6-phenyl-3,4-dihydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R)-2-oxo-6-phenyl-3,4-dihydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 124637729 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl (1R)-2-oxo-6-phenyl-3,4-dihydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)CCc2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H18O3/c1-2-22-19(21)18-16-10-8-14(13-6-4-3-5-7-13)12-15(16)9-11-17(18)20/h3-8,10,12,18H,2,9,11H2,1H3/t18-/m1/s1 |
| InChIKey | MOBGGYBTYWSLMG-GOSISDBHSA-N |
| XLogP | 3.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|