C20H18O5 — CID 69264177
ethyl 6-(1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-naphthalene-1-carboxylate (PubChem CID 69264177) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 6-(1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl 6-(1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 69264177 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | ethyl 6-(1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CCc2cc(-c3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C20H18O5/c1-2-23-20(22)19-15-6-3-12(9-14(15)4-7-16(19)21)13-5-8-17-18(10-13)25-11-24-17/h3,5-6,8-10,19H,2,4,7,11H2,1H3 |
| InChIKey | NAOUDRDDUXEFMC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|