C15H20O3 — CID 11207391
ethyl 5,5,7-trimethyl-2-oxo-4,6-dihydro-1H-indene-1-carboxylate (PubChem CID 11207391) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl 5,5,7-trimethyl-2-oxo-4,6-dihydro-1H-indene-1-carboxylate.
| Compound Name | ethyl 5,5,7-trimethyl-2-oxo-4,6-dihydro-1H-indene-1-carboxylate |
|---|---|
| PubChem CID | 11207391 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl 5,5,7-trimethyl-2-oxo-4,6-dihydro-1H-indene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C2CC(C)(C)CC(C)=C21 |
| InChI | InChI=1S/C15H20O3/c1-5-18-14(17)13-11(16)6-10-8-15(3,4)7-9(2)12(10)13/h6,13H,5,7-8H2,1-4H3 |
| InChIKey | HIJDWKOETUJRJP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|