C13H18O5 — CID 132821028
diethyl 3-methyl-5-oxocyclohex-3-ene-1,2-dicarboxylate (PubChem CID 132821028) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is diethyl 3-methyl-5-oxocyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-oxocyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 132821028 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | diethyl 3-methyl-5-oxocyclohex-3-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC(=O)C=C(C)C1C(=O)OCC |
| InChI | InChI=1S/C13H18O5/c1-4-17-12(15)10-7-9(14)6-8(3)11(10)13(16)18-5-2/h6,10-11H,4-5,7H2,1-3H3 |
| InChIKey | FEOZQZFWTRUJDF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |