C15H12BrNO5 — CID 7477121
methyl (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-methyl-4-oxo-3H-pyrrole-3-carboxylate (PubChem CID 7477121) has the molecular formula C15H12BrNO5 and a molecular weight of 366.17 g/mol. Its IUPAC name is methyl (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-methyl-4-oxo-3H-pyrrole-3-carboxylate.
| Compound Name | methyl (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-methyl-4-oxo-3H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7477121 |
| Molecular Formula | C15H12BrNO5 |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | methyl (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-methyl-4-oxo-3H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1C(=O)/C(=C\c2cc3c(cc2Br)OCO3)N=C1C |
| InChI | InChI=1S/C15H12BrNO5/c1-7-13(15(19)20-2)14(18)10(17-7)3-8-4-11-12(5-9(8)16)22-6-21-11/h3-5,13H,6H2,1-2H3/b10-3+ |
| InChIKey | UXPOTPJOKWAQOJ-XCVCLJGOSA-N |
| XLogP | 2.35 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|