C16H14BrNO6S — CID 22778762
ethyl 2-[(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 22778762) has the molecular formula C16H14BrNO6S and a molecular weight of 428.26 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl 2-[(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 22778762 |
| Molecular Formula | C16H14BrNO6S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | ethyl 2-[(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1C(=O)S/C(=C/c2cc3c(cc2Br)OCO3)C1=O |
| InChI | InChI=1S/C16H14BrNO6S/c1-3-22-15(20)8(2)18-14(19)13(25-16(18)21)5-9-4-11-12(6-10(9)17)24-7-23-11/h4-6,8H,3,7H2,1-2H3/b13-5+ |
| InChIKey | GSKXYHVOCXCCKV-WLRTZDKTSA-N |
| XLogP | 3.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|