C9H14O2S2 — CID 99996163
methyl (8R)-1,4-dithiaspiro[4.4]nonane-8-carboxylate (PubChem CID 99996163) has the molecular formula C9H14O2S2 and a molecular weight of 218.34 g/mol. Its IUPAC name is methyl (8R)-1,4-dithiaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl (8R)-1,4-dithiaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 99996163 |
| Molecular Formula | C9H14O2S2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | methyl (8R)-1,4-dithiaspiro[4.4]nonane-8-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC2(C1)SCCS2 |
| InChI | InChI=1S/C9H14O2S2/c1-11-8(10)7-2-3-9(6-7)12-4-5-13-9/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | VRAJNPCLTVXCQN-SSDOTTSWSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |