C10H17NO4 — CID 112535163
methyl 4-(formamidomethyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 112535163) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl 4-(formamidomethyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | methyl 4-(formamidomethyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 112535163 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methyl 4-(formamidomethyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(O)(CNC=O)CC1 |
| InChI | InChI=1S/C10H17NO4/c1-15-9(13)8-2-4-10(14,5-3-8)6-11-7-12/h7-8,14H,2-6H2,1H3,(H,11,12) |
| InChIKey | FCHDNZZGQHRHHO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|