C14H23NO5 — CID 112535165
methyl 4-hydroxy-4-[(oxolane-3-carbonylamino)methyl]cyclohexane-1-carboxylate (PubChem CID 112535165) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 4-hydroxy-4-[(oxolane-3-carbonylamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-hydroxy-4-[(oxolane-3-carbonylamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 112535165 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | methyl 4-hydroxy-4-[(oxolane-3-carbonylamino)methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(O)(CNC(=O)C2CCOC2)CC1 |
| InChI | InChI=1S/C14H23NO5/c1-19-13(17)10-2-5-14(18,6-3-10)9-15-12(16)11-4-7-20-8-11/h10-11,18H,2-9H2,1H3,(H,15,16) |
| InChIKey | FCJDERASXMZBCR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |