C17H31NO3 — CID 111115377
N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxane-3-carboxamide (PubChem CID 111115377) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxane-3-carboxamide.
| Compound Name | N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 111115377 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxane-3-carboxamide |
| SMILES | CC(C)(C)C1CCC(O)(CNC(=O)C2CCCOC2)CC1 |
| InChI | InChI=1S/C17H31NO3/c1-16(2,3)14-6-8-17(20,9-7-14)12-18-15(19)13-5-4-10-21-11-13/h13-14,20H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | KADLRBOUMQREDQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |