C16H29NO3 — CID 95325025
(3S)-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxolane-3-carboxamide (PubChem CID 95325025) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (3S)-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 95325025 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (3S)-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]oxolane-3-carboxamide |
| SMILES | CC(C)(C)C1CCC(O)(CNC(=O)[C@H]2CCOC2)CC1 |
| InChI | InChI=1S/C16H29NO3/c1-15(2,3)13-4-7-16(19,8-5-13)11-17-14(18)12-6-9-20-10-12/h12-13,19H,4-11H2,1-3H3,(H,17,18)/t12-,13?,16?/m0/s1 |
| InChIKey | ZDCFAUVFBWARNM-FUJMWEONSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |