C18H32N2O3 — CID 111434286
1-acetyl-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 111434286) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-acetyl-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111434286 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1-acetyl-N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC1C(=O)NCC1(O)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H32N2O3/c1-13(21)20-11-5-6-15(20)16(22)19-12-18(23)9-7-14(8-10-18)17(2,3)4/h14-15,23H,5-12H2,1-4H3,(H,19,22) |
| InChIKey | WDJWXOJJTAFIBB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |