C9H18ClNO3 — CID 75537501
methyl 4-(aminomethyl)-4-hydroxycyclohexane-1-carboxylate;hydrochloride (PubChem CID 75537501) has the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. Its IUPAC name is methyl 4-(aminomethyl)-4-hydroxycyclohexane-1-carboxylate;hydrochloride.
| Compound Name | methyl 4-(aminomethyl)-4-hydroxycyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 75537501 |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 4-(aminomethyl)-4-hydroxycyclohexane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CCC(O)(CN)CC1.Cl |
| InChI | InChI=1S/C9H17NO3.ClH/c1-13-8(11)7-2-4-9(12,6-10)5-3-7;/h7,12H,2-6,10H2,1H3;1H |
| InChIKey | PYMBBTGGVZBSCJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |