C8H18ClNO3S — CID 146279083
1-(aminomethyl)-4-methylsulfonylcyclohexan-1-ol;hydrochloride (PubChem CID 146279083) has the molecular formula C8H18ClNO3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 1-(aminomethyl)-4-methylsulfonylcyclohexan-1-ol;hydrochloride.
| Compound Name | 1-(aminomethyl)-4-methylsulfonylcyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 146279083 |
| Molecular Formula | C8H18ClNO3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(aminomethyl)-4-methylsulfonylcyclohexan-1-ol;hydrochloride |
| SMILES | CS(=O)(=O)C1CCC(O)(CN)CC1.Cl |
| InChI | InChI=1S/C8H17NO3S.ClH/c1-13(11,12)7-2-4-8(10,6-9)5-3-7;/h7,10H,2-6,9H2,1H3;1H |
| InChIKey | RCJPPGUWBOCOJI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |