C13H26O2S — CID 176767659
4-methylsulfonyl-1,1-di(propan-2-yl)cyclohexane (PubChem CID 176767659) has the molecular formula C13H26O2S and a molecular weight of 246.42 g/mol. Its IUPAC name is 4-methylsulfonyl-1,1-di(propan-2-yl)cyclohexane.
| Compound Name | 4-methylsulfonyl-1,1-di(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 176767659 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-methylsulfonyl-1,1-di(propan-2-yl)cyclohexane |
| SMILES | CC(C)C1(C(C)C)CCC(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H26O2S/c1-10(2)13(11(3)4)8-6-12(7-9-13)16(5,14)15/h10-12H,6-9H2,1-5H3 |
| InChIKey | BXCPKKYYOFXAPY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |