C8H16O4S — CID 99997590
[(3S)-1-(hydroxymethyl)-3-methylsulfonylcyclopentyl]methanol (PubChem CID 99997590) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is [(3S)-1-(hydroxymethyl)-3-methylsulfonylcyclopentyl]methanol.
| Compound Name | [(3S)-1-(hydroxymethyl)-3-methylsulfonylcyclopentyl]methanol |
|---|---|
| PubChem CID | 99997590 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | [(3S)-1-(hydroxymethyl)-3-methylsulfonylcyclopentyl]methanol |
| SMILES | CS(=O)(=O)[C@H]1CCC(CO)(CO)C1 |
| InChI | InChI=1S/C8H16O4S/c1-13(11,12)7-2-3-8(4-7,5-9)6-10/h7,9-10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | PEQFZIBIQAUMRM-ZETCQYMHSA-N |
| XLogP | -0.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |