C10H21NO2S2 — CID 167239749
1-(2,2-dimethyl-4-methylsulfonylpiperidin-1-yl)ethanethiol (PubChem CID 167239749) has the molecular formula C10H21NO2S2 and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylpiperidin-1-yl)ethanethiol.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylpiperidin-1-yl)ethanethiol |
|---|---|
| PubChem CID | 167239749 |
| Molecular Formula | C10H21NO2S2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylpiperidin-1-yl)ethanethiol |
| SMILES | CC(S)N1CCC(S(C)(=O)=O)CC1(C)C |
| InChI | InChI=1S/C10H21NO2S2/c1-8(14)11-6-5-9(15(4,12)13)7-10(11,2)3/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | NQEIBXRKSJIJBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|