C5H12N2O4S2 — CID 57434350
3-methylsulfonylpyrrolidine-1-sulfonamide (PubChem CID 57434350) has the molecular formula C5H12N2O4S2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-methylsulfonylpyrrolidine-1-sulfonamide.
| Compound Name | 3-methylsulfonylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 57434350 |
| Molecular Formula | C5H12N2O4S2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 3-methylsulfonylpyrrolidine-1-sulfonamide |
| SMILES | CS(=O)(=O)C1CCN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C5H12N2O4S2/c1-12(8,9)5-2-3-7(4-5)13(6,10)11/h5H,2-4H2,1H3,(H2,6,10,11) |
| InChIKey | QJMGZPJMGCSKDX-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |