C7H16N2O2S — CID 45080623
(3R,4S)-3,4-dimethylpiperidine-1-sulfonamide (PubChem CID 45080623) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide.
| Compound Name | (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 45080623 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide |
| SMILES | C[C@H]1CCN(S(N)(=O)=O)C[C@@H]1C |
| InChI | InChI=1S/C7H16N2O2S/c1-6-3-4-9(5-7(6)2)12(8,10)11/h6-7H,3-5H2,1-2H3,(H2,8,10,11)/t6-,7-/m0/s1 |
| InChIKey | PXRPETPZDWVCOA-BQBZGAKWSA-N |
| XLogP | 0.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |