About (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide
(3R,4S)-3,4-dimethylpiperidine-1-sulfonamide (PubChem CID 45080623) has the molecular formula C7H16N2O2S
and a molecular weight of 192.28 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 45080623 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide |
| SMILES | C[C@H]1CCN(S(N)(=O)=O)C[C@@H]1C |
| InChI | InChI=1S/C7H16N2O2S/c1-6-3-4-9(5-7(6)2)12(8,10)11/h6-7H,3-5H2,1-2H3,(H2,8,10,11)/t6-,7-/m0/s1 |
| InChIKey | PXRPETPZDWVCOA-BQBZGAKWSA-N |
| XLogP | 0.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide?
The IUPAC name of (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide (CID 45080623) is (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide is C[C@H]1CCN(S(N)(=O)=O)C[C@@H]1C.
What is the InChIKey of (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide?
The InChIKey is PXRPETPZDWVCOA-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H16N2O2S/c1-6-3-4-9(5-7(6)2)12(8,10)11/h6-7H,3-5H2,1-2H3,(H2,8,10,11)/t6-,7-/m0/s1.
What are the key properties of (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide?
(3R,4S)-3,4-dimethylpiperidine-1-sulfonamide has a molecular weight of 192.28 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 45080623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).