About (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine
(3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine (PubChem CID 177325459) has the molecular formula C10H21NO2S
and a molecular weight of 219.35 g/mol. Its IUPAC name is (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine.
Molecular Properties
| Compound Name | (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine |
| PubChem CID | 177325459 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C10H21NO2S/c1-8(2)14(12,13)11-6-5-9(3)10(4)7-11/h8-10H,5-7H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | YETRLHJUQUVIDD-AXDSSHIGSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine?
The IUPAC name of (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine (CID 177325459) is (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine.
What is the SMILES notation for (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine?
The canonical SMILES for (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine is CC1CCN(S(=O)(=O)C(C)C)C[C@@H]1C.
What is the InChIKey of (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine?
The InChIKey is YETRLHJUQUVIDD-AXDSSHIGSA-N. The full InChI is InChI=1S/C10H21NO2S/c1-8(2)14(12,13)11-6-5-9(3)10(4)7-11/h8-10H,5-7H2,1-4H3/t9?,10-/m0/s1.
What are the key properties of (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine?
(3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine has a molecular weight of 219.35 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4-dimethyl-1-propan-2-ylsulfonylpiperidine is sourced from PubChem (CID 177325459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).