C46H58O10P2 — CID 159126661
(2S,3S,8R)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane;(2S,3S,8S)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 159126661) has the molecular formula C46H58O10P2 and a molecular weight of 832.91 g/mol. Its IUPAC name is (2S,3S,8R)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane;(2S,3S,8S)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane.
| Compound Name | (2S,3S,8R)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane;(2S,3S,8S)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 159126661 |
| Molecular Formula | C46H58O10P2 |
| Molecular Weight | 832.91 g/mol |
| Exact Mass | 832.35 |
| IUPAC Name | (2S,3S,8R)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane;(2S,3S,8S)-8-diethoxyphosphoryl-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | CCOP(=O)(OCC)[C@@H]1CCC2(C1)O[C@@H](c1ccccc1)[C@H](c1ccccc1)O2.CCOP(=O)(OCC)[C@H]1CCC2(C1)O[C@@H](c1ccccc1)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/2C23H29O5P/c2*1-3-25-29(24,26-4-2)20-15-16-23(17-20)27-21(18-11-7-5-8-12-18)22(28-23)19-13-9-6-10-14-19/h2*5-14,20-22H,3-4,15-17H2,1-2H3/t20-,21+,22+;20-,21-,22-/m10/s1 |
| InChIKey | KGJCXUPKYRHQMH-BEZFACBCSA-N |
| XLogP | 12.06 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.91 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|