C15H21O4P — CID 11748465
5-diethoxyphosphoryl-2-phenyl-3,4-dihydro-2H-pyran (PubChem CID 11748465) has the molecular formula C15H21O4P and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-2-phenyl-3,4-dihydro-2H-pyran.
| Compound Name | 5-diethoxyphosphoryl-2-phenyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11748465 |
| Molecular Formula | C15H21O4P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-diethoxyphosphoryl-2-phenyl-3,4-dihydro-2H-pyran |
| SMILES | CCOP(=O)(OCC)C1=COC(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21O4P/c1-3-18-20(16,19-4-2)14-10-11-15(17-12-14)13-8-6-5-7-9-13/h5-9,12,15H,3-4,10-11H2,1-2H3 |
| InChIKey | ILLKUYADQPCXNT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|