C12H21O5P — CID 73117051
3-diethoxyphosphoryl-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran (PubChem CID 73117051) has the molecular formula C12H21O5P and a molecular weight of 276.27 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran.
| Compound Name | 3-diethoxyphosphoryl-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran |
|---|---|
| PubChem CID | 73117051 |
| Molecular Formula | C12H21O5P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-diethoxyphosphoryl-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran |
| SMILES | CCOP(=O)(OCC)C1=COC2OCCCC2C1 |
| InChI | InChI=1S/C12H21O5P/c1-3-16-18(13,17-4-2)11-8-10-6-5-7-14-12(10)15-9-11/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | RJMCKQRJBHWUEU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|