C13H19O5P — CID 2773704
2-(4-diethoxyphosphorylphenyl)-1,3-dioxolane (PubChem CID 2773704) has the molecular formula C13H19O5P and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-(4-diethoxyphosphorylphenyl)-1,3-dioxolane.
| Compound Name | 2-(4-diethoxyphosphorylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 2773704 |
| Molecular Formula | C13H19O5P |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(4-diethoxyphosphorylphenyl)-1,3-dioxolane |
| SMILES | CCOP(=O)(OCC)c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C13H19O5P/c1-3-17-19(14,18-4-2)12-7-5-11(6-8-12)13-15-9-10-16-13/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | CINQUYDQNZUQMK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|