C16H30NO4P — CID 134932206
1-(5-diethoxyphosphoryl-3,3-dimethyl-2,4-dihydropyran-2-yl)piperidine (PubChem CID 134932206) has the molecular formula C16H30NO4P and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(5-diethoxyphosphoryl-3,3-dimethyl-2,4-dihydropyran-2-yl)piperidine.
| Compound Name | 1-(5-diethoxyphosphoryl-3,3-dimethyl-2,4-dihydropyran-2-yl)piperidine |
|---|---|
| PubChem CID | 134932206 |
| Molecular Formula | C16H30NO4P |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(5-diethoxyphosphoryl-3,3-dimethyl-2,4-dihydropyran-2-yl)piperidine |
| SMILES | CCOP(=O)(OCC)C1=COC(N2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C16H30NO4P/c1-5-20-22(18,21-6-2)14-12-16(3,4)15(19-13-14)17-10-8-7-9-11-17/h13,15H,5-12H2,1-4H3 |
| InChIKey | FLYLYVOQBHMSAB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|