C10H18IO4P — CID 15162431
3-diethoxyphosphoryl-4-iodo-5,5-dimethyl-2H-furan (PubChem CID 15162431) has the molecular formula C10H18IO4P and a molecular weight of 360.13 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-4-iodo-5,5-dimethyl-2H-furan.
| Compound Name | 3-diethoxyphosphoryl-4-iodo-5,5-dimethyl-2H-furan |
|---|---|
| PubChem CID | 15162431 |
| Molecular Formula | C10H18IO4P |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3-diethoxyphosphoryl-4-iodo-5,5-dimethyl-2H-furan |
| SMILES | CCOP(=O)(OCC)C1=C(I)C(C)(C)OC1 |
| InChI | InChI=1S/C10H18IO4P/c1-5-14-16(12,15-6-2)8-7-13-10(3,4)9(8)11/h5-7H2,1-4H3 |
| InChIKey | UHFRBFJLURWVLE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|