C12H25O3PS2Si — CID 10783383
(3-diethoxyphosphoryl-6,7-dihydro-5H-1,4-dithiepin-2-yl)-trimethylsilane (PubChem CID 10783383) has the molecular formula C12H25O3PS2Si and a molecular weight of 340.52 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-6,7-dihydro-5H-1,4-dithiepin-2-yl)-trimethylsilane.
| Compound Name | (3-diethoxyphosphoryl-6,7-dihydro-5H-1,4-dithiepin-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10783383 |
| Molecular Formula | C12H25O3PS2Si |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (3-diethoxyphosphoryl-6,7-dihydro-5H-1,4-dithiepin-2-yl)-trimethylsilane |
| SMILES | CCOP(=O)(OCC)C1=C([Si](C)(C)C)SCCCS1 |
| InChI | InChI=1S/C12H25O3PS2Si/c1-6-14-16(13,15-7-2)11-12(19(3,4)5)18-10-8-9-17-11/h6-10H2,1-5H3 |
| InChIKey | RYCJDZXRDUCCJB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|