C13H25O4PS2 — CID 10807098
1-diethoxyphosphoryl-1-(1,3-dithian-2-ylidene)-3-methylbutan-2-ol (PubChem CID 10807098) has the molecular formula C13H25O4PS2 and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1-(1,3-dithian-2-ylidene)-3-methylbutan-2-ol.
| Compound Name | 1-diethoxyphosphoryl-1-(1,3-dithian-2-ylidene)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 10807098 |
| Molecular Formula | C13H25O4PS2 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-diethoxyphosphoryl-1-(1,3-dithian-2-ylidene)-3-methylbutan-2-ol |
| SMILES | CCOP(=O)(OCC)C(=C1SCCCS1)C(O)C(C)C |
| InChI | InChI=1S/C13H25O4PS2/c1-5-16-18(15,17-6-2)12(11(14)10(3)4)13-19-8-7-9-20-13/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | HDWFGJJSFJLUDQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|