C16H29O4PS2 — CID 10833657
1-cyclohexyl-2-diethoxyphosphoryl-2-(1,3-dithian-2-ylidene)ethanol (PubChem CID 10833657) has the molecular formula C16H29O4PS2 and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-cyclohexyl-2-diethoxyphosphoryl-2-(1,3-dithian-2-ylidene)ethanol.
| Compound Name | 1-cyclohexyl-2-diethoxyphosphoryl-2-(1,3-dithian-2-ylidene)ethanol |
|---|---|
| PubChem CID | 10833657 |
| Molecular Formula | C16H29O4PS2 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-cyclohexyl-2-diethoxyphosphoryl-2-(1,3-dithian-2-ylidene)ethanol |
| SMILES | CCOP(=O)(OCC)C(=C1SCCCS1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C16H29O4PS2/c1-3-19-21(18,20-4-2)15(16-22-11-8-12-23-16)14(17)13-9-6-5-7-10-13/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | RQOXRXNNJKDOJM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|