C24H32NO3P — CID 11058740
N-[cyclohexyl(diethoxyphosphoryl)methyl]-1,1-diphenylmethanimine (PubChem CID 11058740) has the molecular formula C24H32NO3P and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[cyclohexyl(diethoxyphosphoryl)methyl]-1,1-diphenylmethanimine.
| Compound Name | N-[cyclohexyl(diethoxyphosphoryl)methyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11058740 |
| Molecular Formula | C24H32NO3P |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[cyclohexyl(diethoxyphosphoryl)methyl]-1,1-diphenylmethanimine |
| SMILES | CCOP(=O)(OCC)C(N=C(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H32NO3P/c1-3-27-29(26,28-4-2)24(22-18-12-7-13-19-22)25-23(20-14-8-5-9-15-20)21-16-10-6-11-17-21/h5-6,8-11,14-17,22,24H,3-4,7,12-13,18-19H2,1-2H3 |
| InChIKey | KCRATSJLITYKLO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|