C22H27N2O3P — CID 53349146
(2R,4S)-4-(benzhydrylideneamino)-4-diethoxyphosphoryl-2-methylbutanenitrile (PubChem CID 53349146) has the molecular formula C22H27N2O3P and a molecular weight of 398.44 g/mol. Its IUPAC name is (2R,4S)-4-(benzhydrylideneamino)-4-diethoxyphosphoryl-2-methylbutanenitrile.
| Compound Name | (2R,4S)-4-(benzhydrylideneamino)-4-diethoxyphosphoryl-2-methylbutanenitrile |
|---|---|
| PubChem CID | 53349146 |
| Molecular Formula | C22H27N2O3P |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2R,4S)-4-(benzhydrylideneamino)-4-diethoxyphosphoryl-2-methylbutanenitrile |
| SMILES | CCOP(=O)(OCC)[C@@H](CC(C)C#N)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N2O3P/c1-4-26-28(25,27-5-2)21(16-18(3)17-23)24-22(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18,21H,4-5,16H2,1-3H3/t18?,21-/m0/s1 |
| InChIKey | IXKOHPLBFYBQBU-ZYZRXSCRSA-N |
| XLogP | 5.67 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|