C33H43NO8P2 — CID 122216670
methyl (2S,3R)-2-(benzhydrylideneamino)-4,4-bis(diethoxyphosphoryl)-3-(4-methylphenyl)butanoate (PubChem CID 122216670) has the molecular formula C33H43NO8P2 and a molecular weight of 643.65 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylideneamino)-4,4-bis(diethoxyphosphoryl)-3-(4-methylphenyl)butanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylideneamino)-4,4-bis(diethoxyphosphoryl)-3-(4-methylphenyl)butanoate |
|---|---|
| PubChem CID | 122216670 |
| Molecular Formula | C33H43NO8P2 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylideneamino)-4,4-bis(diethoxyphosphoryl)-3-(4-methylphenyl)butanoate |
| SMILES | CCOP(=O)(OCC)C([C@H](c1ccc(C)cc1)[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C33H43NO8P2/c1-7-39-43(36,40-8-2)33(44(37,41-9-3)42-10-4)29(26-23-21-25(5)22-24-26)31(32(35)38-6)34-30(27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-24,29,31,33H,7-10H2,1-6H3/t29-,31+/m1/s1 |
| InChIKey | NZKDYALDVJIZLU-VEEOACQBSA-N |
| XLogP | 8.02 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|