C20H25BrNO3P — CID 101160182
N-(3-bromo-1-diethoxyphosphorylpropyl)-1,1-diphenylmethanimine (PubChem CID 101160182) has the molecular formula C20H25BrNO3P and a molecular weight of 438.30 g/mol. Its IUPAC name is N-(3-bromo-1-diethoxyphosphorylpropyl)-1,1-diphenylmethanimine.
| Compound Name | N-(3-bromo-1-diethoxyphosphorylpropyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 101160182 |
| Molecular Formula | C20H25BrNO3P |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-(3-bromo-1-diethoxyphosphorylpropyl)-1,1-diphenylmethanimine |
| SMILES | CCOP(=O)(OCC)C(CCBr)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25BrNO3P/c1-3-24-26(23,25-4-2)19(15-16-21)22-20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19H,3-4,15-16H2,1-2H3 |
| InChIKey | SOIWGFPEXKLWMV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|