C20H33N2O3PS — CID 25223659
1-[(1S)-1-cyclohexylethyl]-3-[diethoxyphosphoryl(phenyl)methyl]thiourea (PubChem CID 25223659) has the molecular formula C20H33N2O3PS and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-[(1S)-1-cyclohexylethyl]-3-[diethoxyphosphoryl(phenyl)methyl]thiourea.
| Compound Name | 1-[(1S)-1-cyclohexylethyl]-3-[diethoxyphosphoryl(phenyl)methyl]thiourea |
|---|---|
| PubChem CID | 25223659 |
| Molecular Formula | C20H33N2O3PS |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[(1S)-1-cyclohexylethyl]-3-[diethoxyphosphoryl(phenyl)methyl]thiourea |
| SMILES | CCOP(=O)(OCC)C(NC(=S)N[C@@H](C)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H33N2O3PS/c1-4-24-26(23,25-5-2)19(18-14-10-7-11-15-18)22-20(27)21-16(3)17-12-8-6-9-13-17/h7,10-11,14-17,19H,4-6,8-9,12-13H2,1-3H3,(H2,21,22,27)/t16-,19?/m0/s1 |
| InChIKey | BLADAJQBXMYKDO-UCFFOFKASA-N |
| XLogP | 5.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|