C19H29O4PS — CID 134845738
(3R)-3-cyclohexyl-3-diethoxyphosphorylsulfanyl-1-phenylpropan-1-one (PubChem CID 134845738) has the molecular formula C19H29O4PS and a molecular weight of 384.48 g/mol. Its IUPAC name is (3R)-3-cyclohexyl-3-diethoxyphosphorylsulfanyl-1-phenylpropan-1-one.
| Compound Name | (3R)-3-cyclohexyl-3-diethoxyphosphorylsulfanyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 134845738 |
| Molecular Formula | C19H29O4PS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3R)-3-cyclohexyl-3-diethoxyphosphorylsulfanyl-1-phenylpropan-1-one |
| SMILES | CCOP(=O)(OCC)S[C@H](CC(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H29O4PS/c1-3-22-24(21,23-4-2)25-19(17-13-9-6-10-14-17)15-18(20)16-11-7-5-8-12-16/h5,7-8,11-12,17,19H,3-4,6,9-10,13-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | IQDWKOXKXYJDKX-LJQANCHMSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|