C16H27NO — CID 65023139
cyclooctyl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol (PubChem CID 65023139) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is cyclooctyl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol.
| Compound Name | cyclooctyl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 65023139 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | cyclooctyl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
| SMILES | Cc1[nH]c(C(O)C2CCCCCCC2)c(C)c1C |
| InChI | InChI=1S/C16H27NO/c1-11-12(2)15(17-13(11)3)16(18)14-9-7-5-4-6-8-10-14/h14,16-18H,4-10H2,1-3H3 |
| InChIKey | MBMACSQEJJTLKJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |