About CID 10501710
CID 10501710 (PubChem CID 10501710) has the molecular formula C12H17O
and a molecular weight of 177.27 g/mol.
Molecular Properties
| Compound Name | CID 10501710 |
| PubChem CID | 10501710 |
| Molecular Formula | C12H17O |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | — |
| SMILES | OC([C]1[CH][CH][CH][CH]1)C1CCCCC1 |
| InChI | InChI=1S/C12H17O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8-10,12-13H,1-3,6-7H2 |
| InChIKey | RCFVQNNCBGQNSQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 10501710 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10501710?
The IUPAC name of CID 10501710 (CID 10501710) is not available.
What is the SMILES notation for CID 10501710?
The canonical SMILES for CID 10501710 is OC([C]1[CH][CH][CH][CH]1)C1CCCCC1.
What is the InChIKey of CID 10501710?
The InChIKey is RCFVQNNCBGQNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8-10,12-13H,1-3,6-7H2.
What are the key properties of CID 10501710?
CID 10501710 has a molecular weight of 177.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10501710 is sourced from PubChem (CID 10501710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).