C12H18O — CID 15442794
cyclohexyl(cyclopenta-1,3-dien-1-yl)methanol (PubChem CID 15442794) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is cyclohexyl(cyclopenta-1,3-dien-1-yl)methanol.
| Compound Name | cyclohexyl(cyclopenta-1,3-dien-1-yl)methanol |
|---|---|
| PubChem CID | 15442794 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | cyclohexyl(cyclopenta-1,3-dien-1-yl)methanol |
| SMILES | OC(C1=CC=CC1)C1CCCCC1 |
| InChI | InChI=1S/C12H18O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8,10,12-13H,1-3,6-7,9H2 |
| InChIKey | OHXYDYJUNDYTJL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |