C13H21NO2 — CID 63927087
oxan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol (PubChem CID 63927087) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is oxan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol.
| Compound Name | oxan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 63927087 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | oxan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
| SMILES | Cc1[nH]c(C(O)C2CCCOC2)c(C)c1C |
| InChI | InChI=1S/C13H21NO2/c1-8-9(2)12(14-10(8)3)13(15)11-5-4-6-16-7-11/h11,13-15H,4-7H2,1-3H3 |
| InChIKey | GYCKLNCCIXQIHZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |